About 6-bromo-5-methoxy-[1,3]thiazolo[4,5-b]pyridin-2-amine;ethane
6-bromo-5-methoxy-[1,3]thiazolo[4,5-b]pyridin-2-amine;ethane (PubChem CID 163251405) has the molecular formula C9H12BrN3OS
and a molecular weight of 290.19 g/mol. Its IUPAC name is 6-bromo-5-methoxy-[1,3]thiazolo[4,5-b]pyridin-2-amine;ethane.
Molecular Properties
| Compound Name | 6-bromo-5-methoxy-[1,3]thiazolo[4,5-b]pyridin-2-amine;ethane |
| PubChem CID | 163251405 |
| Molecular Formula | C9H12BrN3OS |
| Molecular Weight | 290.19 g/mol |
| Exact Mass | 288.99 |
| IUPAC Name | 6-bromo-5-methoxy-[1,3]thiazolo[4,5-b]pyridin-2-amine;ethane |
| SMILES | CC.COc1nc2nc(N)sc2cc1Br |
| InChI | InChI=1S/C7H6BrN3OS.C2H6/c1-12-6-3(8)2-4-5(10-6)11-7(9)13-4;1-2/h2H,1H3,(H2,9,10,11);1-2H3 |
| InChIKey | GOUHGISJUCBHRX-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.19 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-bromo-5-methoxy-[1,3]thiazolo[4,5-b]pyridin-2-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-5-methoxy-[1,3]thiazolo[4,5-b]pyridin-2-amine;ethane?
The IUPAC name of 6-bromo-5-methoxy-[1,3]thiazolo[4,5-b]pyridin-2-amine;ethane (CID 163251405) is 6-bromo-5-methoxy-[1,3]thiazolo[4,5-b]pyridin-2-amine;ethane.
What is the SMILES notation for 6-bromo-5-methoxy-[1,3]thiazolo[4,5-b]pyridin-2-amine;ethane?
The canonical SMILES for 6-bromo-5-methoxy-[1,3]thiazolo[4,5-b]pyridin-2-amine;ethane is CC.COc1nc2nc(N)sc2cc1Br.
What is the InChIKey of 6-bromo-5-methoxy-[1,3]thiazolo[4,5-b]pyridin-2-amine;ethane?
The InChIKey is GOUHGISJUCBHRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6BrN3OS.C2H6/c1-12-6-3(8)2-4-5(10-6)11-7(9)13-4;1-2/h2H,1H3,(H2,9,10,11);1-2H3.
What are the key properties of 6-bromo-5-methoxy-[1,3]thiazolo[4,5-b]pyridin-2-amine;ethane?
6-bromo-5-methoxy-[1,3]thiazolo[4,5-b]pyridin-2-amine;ethane has a molecular weight of 290.19 g/mol, XLogP of 3.07, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-5-methoxy-[1,3]thiazolo[4,5-b]pyridin-2-amine;ethane is sourced from PubChem (CID 163251405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).