C24H30N4O4 — CID 163252100
4-(cyclopropylmethyl)morpholine;N-[3-(2,6-dimethoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-6-yl]formamide (PubChem CID 163252100) has the molecular formula C24H30N4O4 and a molecular weight of 438.53 g/mol. Its IUPAC name is 4-(cyclopropylmethyl)morpholine;N-[3-(2,6-dimethoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-6-yl]formamide.
| Compound Name | 4-(cyclopropylmethyl)morpholine;N-[3-(2,6-dimethoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-6-yl]formamide |
|---|---|
| PubChem CID | 163252100 |
| Molecular Formula | C24H30N4O4 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | 4-(cyclopropylmethyl)morpholine;N-[3-(2,6-dimethoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-6-yl]formamide |
| SMILES | C1CN(CC2CC2)CCO1.COc1cccc(OC)c1-c1c[nH]c2nc(NC=O)ccc12 |
| InChI | InChI=1S/C16H15N3O3.C8H15NO/c1-21-12-4-3-5-13(22-2)15(12)11-8-17-16-10(11)6-7-14(19-16)18-9-20;1-2-8(1)7-9-3-5-10-6-4-9/h3-9H,1-2H3,(H2,17,18,19,20);8H,1-7H2 |
| InChIKey | IVLUSJMQPNVPOU-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 88.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|