C23H29N3O3Si — CID 163252146
N-[3-(3-hydroxyphenyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-6-yl]cyclopropanecarboxamide (PubChem CID 163252146) has the molecular formula C23H29N3O3Si and a molecular weight of 423.59 g/mol. Its IUPAC name is N-[3-(3-hydroxyphenyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-6-yl]cyclopropanecarboxamide.
| Compound Name | N-[3-(3-hydroxyphenyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-6-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 163252146 |
| Molecular Formula | C23H29N3O3Si |
| Molecular Weight | 423.59 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | N-[3-(3-hydroxyphenyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-6-yl]cyclopropanecarboxamide |
| SMILES | C[Si](C)(C)CCOCn1cc(-c2cccc(O)c2)c2ccc(NC(=O)C3CC3)nc21 |
| InChI | InChI=1S/C23H29N3O3Si/c1-30(2,3)12-11-29-15-26-14-20(17-5-4-6-18(27)13-17)19-9-10-21(24-22(19)26)25-23(28)16-7-8-16/h4-6,9-10,13-14,16,27H,7-8,11-12,15H2,1-3H3,(H,24,25,28) |
| InChIKey | XKCDMSPCZIIQMA-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.59 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|