About 5-bromo-2-(difluoromethyl)-4,6-dimethoxypyrimidine
5-bromo-2-(difluoromethyl)-4,6-dimethoxypyrimidine (PubChem CID 163252588) has the molecular formula C7H7BrF2N2O2
and a molecular weight of 269.05 g/mol. Its IUPAC name is 5-bromo-2-(difluoromethyl)-4,6-dimethoxypyrimidine.
Molecular Properties
| Compound Name | 5-bromo-2-(difluoromethyl)-4,6-dimethoxypyrimidine |
| PubChem CID | 163252588 |
| Molecular Formula | C7H7BrF2N2O2 |
| Molecular Weight | 269.05 g/mol |
| Exact Mass | 267.97 |
| IUPAC Name | 5-bromo-2-(difluoromethyl)-4,6-dimethoxypyrimidine |
| SMILES | COc1nc(C(F)F)nc(OC)c1Br |
| InChI | InChI=1S/C7H7BrF2N2O2/c1-13-6-3(8)7(14-2)12-5(11-6)4(9)10/h4H,1-2H3 |
| InChIKey | IJXPORIYPVIGSP-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.05 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-bromo-2-(difluoromethyl)-4,6-dimethoxypyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-(difluoromethyl)-4,6-dimethoxypyrimidine?
The IUPAC name of 5-bromo-2-(difluoromethyl)-4,6-dimethoxypyrimidine (CID 163252588) is 5-bromo-2-(difluoromethyl)-4,6-dimethoxypyrimidine.
What is the SMILES notation for 5-bromo-2-(difluoromethyl)-4,6-dimethoxypyrimidine?
The canonical SMILES for 5-bromo-2-(difluoromethyl)-4,6-dimethoxypyrimidine is COc1nc(C(F)F)nc(OC)c1Br.
What is the InChIKey of 5-bromo-2-(difluoromethyl)-4,6-dimethoxypyrimidine?
The InChIKey is IJXPORIYPVIGSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7BrF2N2O2/c1-13-6-3(8)7(14-2)12-5(11-6)4(9)10/h4H,1-2H3.
What are the key properties of 5-bromo-2-(difluoromethyl)-4,6-dimethoxypyrimidine?
5-bromo-2-(difluoromethyl)-4,6-dimethoxypyrimidine has a molecular weight of 269.05 g/mol, XLogP of 2.19, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-(difluoromethyl)-4,6-dimethoxypyrimidine is sourced from PubChem (CID 163252588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).