C18H23N3O2 — CID 163252856
ethane;1-(8-propylisoquinolin-4-yl)-1,3-diazinane-2,4-dione (PubChem CID 163252856) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is ethane;1-(8-propylisoquinolin-4-yl)-1,3-diazinane-2,4-dione.
| Compound Name | ethane;1-(8-propylisoquinolin-4-yl)-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 163252856 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | ethane;1-(8-propylisoquinolin-4-yl)-1,3-diazinane-2,4-dione |
| SMILES | CC.CCCc1cccc2c(N3CCC(=O)NC3=O)cncc12 |
| InChI | InChI=1S/C16H17N3O2.C2H6/c1-2-4-11-5-3-6-12-13(11)9-17-10-14(12)19-8-7-15(20)18-16(19)21;1-2/h3,5-6,9-10H,2,4,7-8H2,1H3,(H,18,20,21);1-2H3 |
| InChIKey | NADKLIQRUQQLLB-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |