C15H23BN4O2 — CID 163253039
N'-[(Z)-1-aminoethylideneamino]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenecarboximidamide (PubChem CID 163253039) has the molecular formula C15H23BN4O2 and a molecular weight of 302.19 g/mol. Its IUPAC name is N'-[(Z)-1-aminoethylideneamino]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenecarboximidamide.
| Compound Name | N'-[(Z)-1-aminoethylideneamino]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenecarboximidamide |
|---|---|
| PubChem CID | 163253039 |
| Molecular Formula | C15H23BN4O2 |
| Molecular Weight | 302.19 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | N'-[(Z)-1-aminoethylideneamino]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenecarboximidamide |
| SMILES | C/C(N)=N/N=C(\N)c1ccc(B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C15H23BN4O2/c1-10(17)19-20-13(18)11-6-8-12(9-7-11)16-21-14(2,3)15(4,5)22-16/h6-9H,1-5H3,(H2,17,19)(H2,18,20) |
| InChIKey | VXQWBWIEOHFYEV-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.19 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|