C25H32N2O5 — CID 163253291
tert-butyl 4-[6-[(4-acetyl-3-methoxyphenyl)methoxy]-2-pyridinyl]piperidine-1-carboxylate (PubChem CID 163253291) has the molecular formula C25H32N2O5 and a molecular weight of 440.54 g/mol. Its IUPAC name is tert-butyl 4-[6-[(4-acetyl-3-methoxyphenyl)methoxy]-2-pyridinyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[6-[(4-acetyl-3-methoxyphenyl)methoxy]-2-pyridinyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 163253291 |
| Molecular Formula | C25H32N2O5 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | tert-butyl 4-[6-[(4-acetyl-3-methoxyphenyl)methoxy]-2-pyridinyl]piperidine-1-carboxylate |
| SMILES | COc1cc(COc2cccc(C3CCN(C(=O)OC(C)(C)C)CC3)n2)ccc1C(C)=O |
| InChI | InChI=1S/C25H32N2O5/c1-17(28)20-10-9-18(15-22(20)30-5)16-31-23-8-6-7-21(26-23)19-11-13-27(14-12-19)24(29)32-25(2,3)4/h6-10,15,19H,11-14,16H2,1-5H3 |
| InChIKey | DEQKYWNPVPDGBM-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 77.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |