C15H10Cl2N4O — CID 163253537
5-(4-chlorophenyl)-3-(1-methylpyrazol-4-yl)pyrazine-2-carbonyl chloride (PubChem CID 163253537) has the molecular formula C15H10Cl2N4O and a molecular weight of 333.18 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-3-(1-methylpyrazol-4-yl)pyrazine-2-carbonyl chloride.
| Compound Name | 5-(4-chlorophenyl)-3-(1-methylpyrazol-4-yl)pyrazine-2-carbonyl chloride |
|---|---|
| PubChem CID | 163253537 |
| Molecular Formula | C15H10Cl2N4O |
| Molecular Weight | 333.18 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | 5-(4-chlorophenyl)-3-(1-methylpyrazol-4-yl)pyrazine-2-carbonyl chloride |
| SMILES | Cn1cc(-c2nc(-c3ccc(Cl)cc3)cnc2C(=O)Cl)cn1 |
| InChI | InChI=1S/C15H10Cl2N4O/c1-21-8-10(6-19-21)13-14(15(17)22)18-7-12(20-13)9-2-4-11(16)5-3-9/h2-8H,1H3 |
| InChIKey | MUUXWIBBOCMQQY-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.18 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|