About N-ethenyl-4,5-dimethyl-1,3-thiazol-2-amine;toluene
N-ethenyl-4,5-dimethyl-1,3-thiazol-2-amine;toluene (PubChem CID 163253844) has the molecular formula C14H18N2S
and a molecular weight of 246.38 g/mol. Its IUPAC name is N-ethenyl-4,5-dimethyl-1,3-thiazol-2-amine;toluene.
Molecular Properties
| Compound Name | N-ethenyl-4,5-dimethyl-1,3-thiazol-2-amine;toluene |
| PubChem CID | 163253844 |
| Molecular Formula | C14H18N2S |
| Molecular Weight | 246.38 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | N-ethenyl-4,5-dimethyl-1,3-thiazol-2-amine;toluene |
| SMILES | C=CNc1nc(C)c(C)s1.Cc1ccccc1 |
| InChI | InChI=1S/C7H10N2S.C7H8/c1-4-8-7-9-5(2)6(3)10-7;1-7-5-3-2-4-6-7/h4H,1H2,2-3H3,(H,8,9);2-6H,1H3 |
| InChIKey | FBDJTGAZPRYIBF-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.38 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-ethenyl-4,5-dimethyl-1,3-thiazol-2-amine;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethenyl-4,5-dimethyl-1,3-thiazol-2-amine;toluene?
The IUPAC name of N-ethenyl-4,5-dimethyl-1,3-thiazol-2-amine;toluene (CID 163253844) is N-ethenyl-4,5-dimethyl-1,3-thiazol-2-amine;toluene.
What is the SMILES notation for N-ethenyl-4,5-dimethyl-1,3-thiazol-2-amine;toluene?
The canonical SMILES for N-ethenyl-4,5-dimethyl-1,3-thiazol-2-amine;toluene is C=CNc1nc(C)c(C)s1.Cc1ccccc1.
What is the InChIKey of N-ethenyl-4,5-dimethyl-1,3-thiazol-2-amine;toluene?
The InChIKey is FBDJTGAZPRYIBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2S.C7H8/c1-4-8-7-9-5(2)6(3)10-7;1-7-5-3-2-4-6-7/h4H,1H2,2-3H3,(H,8,9);2-6H,1H3.
What are the key properties of N-ethenyl-4,5-dimethyl-1,3-thiazol-2-amine;toluene?
N-ethenyl-4,5-dimethyl-1,3-thiazol-2-amine;toluene has a molecular weight of 246.38 g/mol, XLogP of 4.31, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethenyl-4,5-dimethyl-1,3-thiazol-2-amine;toluene is sourced from PubChem (CID 163253844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).