About 2-(6-fluoroimidazo[1,2-a]pyridin-2-yl)-1-[(5-methyl-1H-pyrazol-3-yl)amino]ethanol
2-(6-fluoroimidazo[1,2-a]pyridin-2-yl)-1-[(5-methyl-1H-pyrazol-3-yl)amino]ethanol (PubChem CID 163254872) has the molecular formula C13H14FN5O
and a molecular weight of 275.29 g/mol. Its IUPAC name is 2-(6-fluoroimidazo[1,2-a]pyridin-2-yl)-1-[(5-methyl-1H-pyrazol-3-yl)amino]ethanol.
Molecular Properties
| Compound Name | 2-(6-fluoroimidazo[1,2-a]pyridin-2-yl)-1-[(5-methyl-1H-pyrazol-3-yl)amino]ethanol |
| PubChem CID | 163254872 |
| Molecular Formula | C13H14FN5O |
| Molecular Weight | 275.29 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 2-(6-fluoroimidazo[1,2-a]pyridin-2-yl)-1-[(5-methyl-1H-pyrazol-3-yl)amino]ethanol |
| SMILES | Cc1cc(NC(O)Cc2cn3cc(F)ccc3n2)n[nH]1 |
| InChI | InChI=1S/C13H14FN5O/c1-8-4-11(18-17-8)16-13(20)5-10-7-19-6-9(14)2-3-12(19)15-10/h2-4,6-7,13,20H,5H2,1H3,(H2,16,17,18) |
| InChIKey | DSIMQIZTXXDABW-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 78.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.29 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(6-fluoroimidazo[1,2-a]pyridin-2-yl)-1-[(5-methyl-1H-pyrazol-3-yl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-fluoroimidazo[1,2-a]pyridin-2-yl)-1-[(5-methyl-1H-pyrazol-3-yl)amino]ethanol?
The IUPAC name of 2-(6-fluoroimidazo[1,2-a]pyridin-2-yl)-1-[(5-methyl-1H-pyrazol-3-yl)amino]ethanol (CID 163254872) is 2-(6-fluoroimidazo[1,2-a]pyridin-2-yl)-1-[(5-methyl-1H-pyrazol-3-yl)amino]ethanol.
What is the SMILES notation for 2-(6-fluoroimidazo[1,2-a]pyridin-2-yl)-1-[(5-methyl-1H-pyrazol-3-yl)amino]ethanol?
The canonical SMILES for 2-(6-fluoroimidazo[1,2-a]pyridin-2-yl)-1-[(5-methyl-1H-pyrazol-3-yl)amino]ethanol is Cc1cc(NC(O)Cc2cn3cc(F)ccc3n2)n[nH]1.
What is the InChIKey of 2-(6-fluoroimidazo[1,2-a]pyridin-2-yl)-1-[(5-methyl-1H-pyrazol-3-yl)amino]ethanol?
The InChIKey is DSIMQIZTXXDABW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14FN5O/c1-8-4-11(18-17-8)16-13(20)5-10-7-19-6-9(14)2-3-12(19)15-10/h2-4,6-7,13,20H,5H2,1H3,(H2,16,17,18).
What are the key properties of 2-(6-fluoroimidazo[1,2-a]pyridin-2-yl)-1-[(5-methyl-1H-pyrazol-3-yl)amino]ethanol?
2-(6-fluoroimidazo[1,2-a]pyridin-2-yl)-1-[(5-methyl-1H-pyrazol-3-yl)amino]ethanol has a molecular weight of 275.29 g/mol, XLogP of 1.48, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-fluoroimidazo[1,2-a]pyridin-2-yl)-1-[(5-methyl-1H-pyrazol-3-yl)amino]ethanol is sourced from PubChem (CID 163254872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).