C19H24BN3O4 — CID 163255283
4-amino-N-cyclopropyl-2-oxo-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-quinoline-3-carboxamide (PubChem CID 163255283) has the molecular formula C19H24BN3O4 and a molecular weight of 369.23 g/mol. Its IUPAC name is 4-amino-N-cyclopropyl-2-oxo-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-quinoline-3-carboxamide.
| Compound Name | 4-amino-N-cyclopropyl-2-oxo-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 163255283 |
| Molecular Formula | C19H24BN3O4 |
| Molecular Weight | 369.23 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | 4-amino-N-cyclopropyl-2-oxo-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-quinoline-3-carboxamide |
| SMILES | CC1(C)OB(c2cccc3c(N)c(C(=O)NC4CC4)c(=O)[nH]c23)OC1(C)C |
| InChI | InChI=1S/C19H24BN3O4/c1-18(2)19(3,4)27-20(26-18)12-7-5-6-11-14(21)13(17(25)23-15(11)12)16(24)22-10-8-9-10/h5-7,10H,8-9H2,1-4H3,(H,22,24)(H3,21,23,25) |
| InChIKey | JWIHEONXOZDQAR-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 106.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.23 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|