C18H17ClN4O4S — CID 163255971
1-[4-(4-chloro-2-oxo-1-pyridinyl)phenyl]-N-ethyl-5-methylsulfonylpyrazole-4-carboxamide (PubChem CID 163255971) has the molecular formula C18H17ClN4O4S and a molecular weight of 420.88 g/mol. Its IUPAC name is 1-[4-(4-chloro-2-oxo-1-pyridinyl)phenyl]-N-ethyl-5-methylsulfonylpyrazole-4-carboxamide.
| Compound Name | 1-[4-(4-chloro-2-oxo-1-pyridinyl)phenyl]-N-ethyl-5-methylsulfonylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 163255971 |
| Molecular Formula | C18H17ClN4O4S |
| Molecular Weight | 420.88 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | 1-[4-(4-chloro-2-oxo-1-pyridinyl)phenyl]-N-ethyl-5-methylsulfonylpyrazole-4-carboxamide |
| SMILES | CCNC(=O)c1cnn(-c2ccc(-n3ccc(Cl)cc3=O)cc2)c1S(C)(=O)=O |
| InChI | InChI=1S/C18H17ClN4O4S/c1-3-20-17(25)15-11-21-23(18(15)28(2,26)27)14-6-4-13(5-7-14)22-9-8-12(19)10-16(22)24/h4-11H,3H2,1-2H3,(H,20,25) |
| InChIKey | KOLKLFXTXBVVAX-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.88 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |