About ethane;2-ethyl-4-(5-methylcyclohepta-1,4,6-trien-1-yl)morpholine
ethane;2-ethyl-4-(5-methylcyclohepta-1,4,6-trien-1-yl)morpholine (PubChem CID 163257075) has the molecular formula C18H33NO
and a molecular weight of 279.47 g/mol. Its IUPAC name is ethane;2-ethyl-4-(5-methylcyclohepta-1,4,6-trien-1-yl)morpholine.
Molecular Properties
| Compound Name | ethane;2-ethyl-4-(5-methylcyclohepta-1,4,6-trien-1-yl)morpholine |
| PubChem CID | 163257075 |
| Molecular Formula | C18H33NO |
| Molecular Weight | 279.47 g/mol |
| Exact Mass | 279.26 |
| IUPAC Name | ethane;2-ethyl-4-(5-methylcyclohepta-1,4,6-trien-1-yl)morpholine |
| SMILES | CC.CC.CCC1CN(C2=CCC=C(C)C=C2)CCO1 |
| InChI | InChI=1S/C14H21NO.2C2H6/c1-3-14-11-15(9-10-16-14)13-6-4-5-12(2)7-8-13;2*1-2/h5-8,14H,3-4,9-11H2,1-2H3;2*1-2H3 |
| InChIKey | ASZTXPXBGQVXPN-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.47 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;2-ethyl-4-(5-methylcyclohepta-1,4,6-trien-1-yl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-ethyl-4-(5-methylcyclohepta-1,4,6-trien-1-yl)morpholine?
The IUPAC name of ethane;2-ethyl-4-(5-methylcyclohepta-1,4,6-trien-1-yl)morpholine (CID 163257075) is ethane;2-ethyl-4-(5-methylcyclohepta-1,4,6-trien-1-yl)morpholine.
What is the SMILES notation for ethane;2-ethyl-4-(5-methylcyclohepta-1,4,6-trien-1-yl)morpholine?
The canonical SMILES for ethane;2-ethyl-4-(5-methylcyclohepta-1,4,6-trien-1-yl)morpholine is CC.CC.CCC1CN(C2=CCC=C(C)C=C2)CCO1.
What is the InChIKey of ethane;2-ethyl-4-(5-methylcyclohepta-1,4,6-trien-1-yl)morpholine?
The InChIKey is ASZTXPXBGQVXPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO.2C2H6/c1-3-14-11-15(9-10-16-14)13-6-4-5-12(2)7-8-13;2*1-2/h5-8,14H,3-4,9-11H2,1-2H3;2*1-2H3.
What are the key properties of ethane;2-ethyl-4-(5-methylcyclohepta-1,4,6-trien-1-yl)morpholine?
ethane;2-ethyl-4-(5-methylcyclohepta-1,4,6-trien-1-yl)morpholine has a molecular weight of 279.47 g/mol, XLogP of 4.94, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-ethyl-4-(5-methylcyclohepta-1,4,6-trien-1-yl)morpholine is sourced from PubChem (CID 163257075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).