C8H17NO — CID 163257227
(3aS,6aR)-3,3a,4,5,6,6a-hexahydro-1H-furo[3,4-c]pyrrole;ethane (PubChem CID 163257227) has the molecular formula C8H17NO and a molecular weight of 143.23 g/mol. Its IUPAC name is (3aS,6aR)-3,3a,4,5,6,6a-hexahydro-1H-furo[3,4-c]pyrrole;ethane.
| Compound Name | (3aS,6aR)-3,3a,4,5,6,6a-hexahydro-1H-furo[3,4-c]pyrrole;ethane |
|---|---|
| PubChem CID | 163257227 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | (3aS,6aR)-3,3a,4,5,6,6a-hexahydro-1H-furo[3,4-c]pyrrole;ethane |
| SMILES | C1NC[C@H]2COC[C@@H]12.CC |
| InChI | InChI=1S/C6H11NO.C2H6/c1-5-3-8-4-6(5)2-7-1;1-2/h5-7H,1-4H2;1-2H3/t5-,6+; |
| InChIKey | MCJGTIAQWSJXEH-KNCHESJLSA-N |
| XLogP | 0.88 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |