About ethane;4-methoxy-4-methyl-1-(2,2,2-trifluoroethyl)piperidine
ethane;4-methoxy-4-methyl-1-(2,2,2-trifluoroethyl)piperidine (PubChem CID 163257601) has the molecular formula C13H28F3NO
and a molecular weight of 271.37 g/mol. Its IUPAC name is ethane;4-methoxy-4-methyl-1-(2,2,2-trifluoroethyl)piperidine.
Molecular Properties
| Compound Name | ethane;4-methoxy-4-methyl-1-(2,2,2-trifluoroethyl)piperidine |
| PubChem CID | 163257601 |
| Molecular Formula | C13H28F3NO |
| Molecular Weight | 271.37 g/mol |
| Exact Mass | 271.21 |
| IUPAC Name | ethane;4-methoxy-4-methyl-1-(2,2,2-trifluoroethyl)piperidine |
| SMILES | CC.CC.COC1(C)CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C9H16F3NO.2C2H6/c1-8(14-2)3-5-13(6-4-8)7-9(10,11)12;2*1-2/h3-7H2,1-2H3;2*1-2H3 |
| InChIKey | VANBBOAQDBXMRY-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.37 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;4-methoxy-4-methyl-1-(2,2,2-trifluoroethyl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-methoxy-4-methyl-1-(2,2,2-trifluoroethyl)piperidine?
The IUPAC name of ethane;4-methoxy-4-methyl-1-(2,2,2-trifluoroethyl)piperidine (CID 163257601) is ethane;4-methoxy-4-methyl-1-(2,2,2-trifluoroethyl)piperidine.
What is the SMILES notation for ethane;4-methoxy-4-methyl-1-(2,2,2-trifluoroethyl)piperidine?
The canonical SMILES for ethane;4-methoxy-4-methyl-1-(2,2,2-trifluoroethyl)piperidine is CC.CC.COC1(C)CCN(CC(F)(F)F)CC1.
What is the InChIKey of ethane;4-methoxy-4-methyl-1-(2,2,2-trifluoroethyl)piperidine?
The InChIKey is VANBBOAQDBXMRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16F3NO.2C2H6/c1-8(14-2)3-5-13(6-4-8)7-9(10,11)12;2*1-2/h3-7H2,1-2H3;2*1-2H3.
What are the key properties of ethane;4-methoxy-4-methyl-1-(2,2,2-trifluoroethyl)piperidine?
ethane;4-methoxy-4-methyl-1-(2,2,2-trifluoroethyl)piperidine has a molecular weight of 271.37 g/mol, XLogP of 4.10, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-methoxy-4-methyl-1-(2,2,2-trifluoroethyl)piperidine is sourced from PubChem (CID 163257601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).