About 4-methoxy-4-methyl-1-(2,2,2-trifluoroethyl)piperidine
4-methoxy-4-methyl-1-(2,2,2-trifluoroethyl)piperidine (PubChem CID 163257602) has the molecular formula C9H16F3NO
and a molecular weight of 211.23 g/mol. Its IUPAC name is 4-methoxy-4-methyl-1-(2,2,2-trifluoroethyl)piperidine.
Analyze 4-methoxy-4-methyl-1-(2,2,2-trifluoroethyl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-4-methyl-1-(2,2,2-trifluoroethyl)piperidine?
The IUPAC name of 4-methoxy-4-methyl-1-(2,2,2-trifluoroethyl)piperidine (CID 163257602) is 4-methoxy-4-methyl-1-(2,2,2-trifluoroethyl)piperidine.
What is the SMILES notation for 4-methoxy-4-methyl-1-(2,2,2-trifluoroethyl)piperidine?
The canonical SMILES for 4-methoxy-4-methyl-1-(2,2,2-trifluoroethyl)piperidine is COC1(C)CCN(CC(F)(F)F)CC1.
What is the InChIKey of 4-methoxy-4-methyl-1-(2,2,2-trifluoroethyl)piperidine?
The InChIKey is KZXXBEGAYQSDEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16F3NO/c1-8(14-2)3-5-13(6-4-8)7-9(10,11)12/h3-7H2,1-2H3.
What are the key properties of 4-methoxy-4-methyl-1-(2,2,2-trifluoroethyl)piperidine?
4-methoxy-4-methyl-1-(2,2,2-trifluoroethyl)piperidine has a molecular weight of 211.23 g/mol, XLogP of 2.05, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-4-methyl-1-(2,2,2-trifluoroethyl)piperidine is sourced from PubChem (CID 163257602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).