C13H21N3O2 — CID 163258541
4-[(3-ethyl-3-methoxypyrrolidin-1-yl)methyl]-2-methoxypyrimidine (PubChem CID 163258541) has the molecular formula C13H21N3O2 and a molecular weight of 251.33 g/mol. Its IUPAC name is 4-[(3-ethyl-3-methoxypyrrolidin-1-yl)methyl]-2-methoxypyrimidine.
| Compound Name | 4-[(3-ethyl-3-methoxypyrrolidin-1-yl)methyl]-2-methoxypyrimidine |
|---|---|
| PubChem CID | 163258541 |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | 4-[(3-ethyl-3-methoxypyrrolidin-1-yl)methyl]-2-methoxypyrimidine |
| SMILES | CCC1(OC)CCN(Cc2ccnc(OC)n2)C1 |
| InChI | InChI=1S/C13H21N3O2/c1-4-13(18-3)6-8-16(10-13)9-11-5-7-14-12(15-11)17-2/h5,7H,4,6,8-10H2,1-3H3 |
| InChIKey | CEKHDMBWRJGCQR-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |