C17H15N3O2 — CID 163258838
2-[(4-methoxyphenyl)methyl]-2,5,7-triazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12)-tetraen-3-one (PubChem CID 163258838) has the molecular formula C17H15N3O2 and a molecular weight of 293.33 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)methyl]-2,5,7-triazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12)-tetraen-3-one.
| Compound Name | 2-[(4-methoxyphenyl)methyl]-2,5,7-triazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12)-tetraen-3-one |
|---|---|
| PubChem CID | 163258838 |
| Molecular Formula | C17H15N3O2 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 2-[(4-methoxyphenyl)methyl]-2,5,7-triazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12)-tetraen-3-one |
| SMILES | COc1ccc(CN2C(=O)c3ncnc4c3C2=CCC4)cc1 |
| InChI | InChI=1S/C17H15N3O2/c1-22-12-7-5-11(6-8-12)9-20-14-4-2-3-13-15(14)16(17(20)21)19-10-18-13/h4-8,10H,2-3,9H2,1H3 |
| InChIKey | PUGWLLZVJKJOTJ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |