C21H31BrF3NO2Si — CID 163259766
N-[(1S)-1-(4-bromophenyl)-2,2,2-trifluoroethyl]-4-[tert-butyl(dimethyl)silyl]oxycyclohexane-1-carboxamide (PubChem CID 163259766) has the molecular formula C21H31BrF3NO2Si and a molecular weight of 494.47 g/mol. Its IUPAC name is N-[(1S)-1-(4-bromophenyl)-2,2,2-trifluoroethyl]-4-[tert-butyl(dimethyl)silyl]oxycyclohexane-1-carboxamide.
| Compound Name | N-[(1S)-1-(4-bromophenyl)-2,2,2-trifluoroethyl]-4-[tert-butyl(dimethyl)silyl]oxycyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 163259766 |
| Molecular Formula | C21H31BrF3NO2Si |
| Molecular Weight | 494.47 g/mol |
| Exact Mass | 493.13 |
| IUPAC Name | N-[(1S)-1-(4-bromophenyl)-2,2,2-trifluoroethyl]-4-[tert-butyl(dimethyl)silyl]oxycyclohexane-1-carboxamide |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCC(C(=O)N[C@@H](c2ccc(Br)cc2)C(F)(F)F)CC1 |
| InChI | InChI=1S/C21H31BrF3NO2Si/c1-20(2,3)29(4,5)28-17-12-8-15(9-13-17)19(27)26-18(21(23,24)25)14-6-10-16(22)11-7-14/h6-7,10-11,15,17-18H,8-9,12-13H2,1-5H3,(H,26,27)/t15?,17?,18-/m0/s1 |
| InChIKey | SWTPIKFKKCAHDR-VJFUWPCTSA-N |
| XLogP | 6.75 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.47 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|