C23H26ClF3N6O3 — CID 163259822
N-[(1S)-1-[4-[[2-chloro-7-[(1S)-1-methoxyethyl]-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]amino]phenyl]-2,2,2-trifluoroethyl]-N-methyloxane-2-carboxamide (PubChem CID 163259822) has the molecular formula C23H26ClF3N6O3 and a molecular weight of 526.95 g/mol. Its IUPAC name is N-[(1S)-1-[4-[[2-chloro-7-[(1S)-1-methoxyethyl]-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]amino]phenyl]-2,2,2-trifluoroethyl]-N-methyloxane-2-carboxamide.
| Compound Name | N-[(1S)-1-[4-[[2-chloro-7-[(1S)-1-methoxyethyl]-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]amino]phenyl]-2,2,2-trifluoroethyl]-N-methyloxane-2-carboxamide |
|---|---|
| PubChem CID | 163259822 |
| Molecular Formula | C23H26ClF3N6O3 |
| Molecular Weight | 526.95 g/mol |
| Exact Mass | 526.17 |
| IUPAC Name | N-[(1S)-1-[4-[[2-chloro-7-[(1S)-1-methoxyethyl]-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]amino]phenyl]-2,2,2-trifluoroethyl]-N-methyloxane-2-carboxamide |
| SMILES | CO[C@@H](C)c1c(Nc2ccc([C@H](N(C)C(=O)C3CCCCO3)C(F)(F)F)cc2)cnc2nc(Cl)nn12 |
| InChI | InChI=1S/C23H26ClF3N6O3/c1-13(35-3)18-16(12-28-22-30-21(24)31-33(18)22)29-15-9-7-14(8-10-15)19(23(25,26)27)32(2)20(34)17-6-4-5-11-36-17/h7-10,12-13,17,19,29H,4-6,11H2,1-3H3/t13-,17?,19-/m0/s1 |
| InChIKey | PUPILKDZFYIBQC-VCQVUWNQSA-N |
| XLogP | 4.86 |
| TPSA | 93.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.95 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |