C30H31F3N6O2 — CID 163260692
N-[(1S)-1-[4-[(4-cyclopropyl-1,5-naphthyridin-3-yl)amino]phenyl]-2,2,2-trifluoroethyl]-N-methyl-4-(5-methyl-1,3,4-oxadiazol-2-yl)cyclohexane-1-carboxamide (PubChem CID 163260692) has the molecular formula C30H31F3N6O2 and a molecular weight of 564.61 g/mol. Its IUPAC name is N-[(1S)-1-[4-[(4-cyclopropyl-1,5-naphthyridin-3-yl)amino]phenyl]-2,2,2-trifluoroethyl]-N-methyl-4-(5-methyl-1,3,4-oxadiazol-2-yl)cyclohexane-1-carboxamide.
| Compound Name | N-[(1S)-1-[4-[(4-cyclopropyl-1,5-naphthyridin-3-yl)amino]phenyl]-2,2,2-trifluoroethyl]-N-methyl-4-(5-methyl-1,3,4-oxadiazol-2-yl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 163260692 |
| Molecular Formula | C30H31F3N6O2 |
| Molecular Weight | 564.61 g/mol |
| Exact Mass | 564.25 |
| IUPAC Name | N-[(1S)-1-[4-[(4-cyclopropyl-1,5-naphthyridin-3-yl)amino]phenyl]-2,2,2-trifluoroethyl]-N-methyl-4-(5-methyl-1,3,4-oxadiazol-2-yl)cyclohexane-1-carboxamide |
| SMILES | Cc1nnc(C2CCC(C(=O)N(C)[C@@H](c3ccc(Nc4cnc5cccnc5c4C4CC4)cc3)C(F)(F)F)CC2)o1 |
| InChI | InChI=1S/C30H31F3N6O2/c1-17-37-38-28(41-17)20-7-9-21(10-8-20)29(40)39(2)27(30(31,32)33)19-11-13-22(14-12-19)36-24-16-35-23-4-3-15-34-26(23)25(24)18-5-6-18/h3-4,11-16,18,20-21,27,36H,5-10H2,1-2H3/t20?,21?,27-/m0/s1 |
| InChIKey | RUTRANNFINXLLD-HTLZXYJSSA-N |
| XLogP | 6.98 |
| TPSA | 97.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.61 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |