C21H29N3O2 — CID 163260959
ethane;[6-(4-methoxyanilino)-5-methyl-3-pyridinyl]-piperidin-1-ylmethanone (PubChem CID 163260959) has the molecular formula C21H29N3O2 and a molecular weight of 355.48 g/mol. Its IUPAC name is ethane;[6-(4-methoxyanilino)-5-methyl-3-pyridinyl]-piperidin-1-ylmethanone.
| Compound Name | ethane;[6-(4-methoxyanilino)-5-methyl-3-pyridinyl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 163260959 |
| Molecular Formula | C21H29N3O2 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | ethane;[6-(4-methoxyanilino)-5-methyl-3-pyridinyl]-piperidin-1-ylmethanone |
| SMILES | CC.COc1ccc(Nc2ncc(C(=O)N3CCCCC3)cc2C)cc1 |
| InChI | InChI=1S/C19H23N3O2.C2H6/c1-14-12-15(19(23)22-10-4-3-5-11-22)13-20-18(14)21-16-6-8-17(24-2)9-7-16;1-2/h6-9,12-13H,3-5,10-11H2,1-2H3,(H,20,21);1-2H3 |
| InChIKey | HMNAZFCEQGKLTB-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |