C21H24F2N4O2 — CID 163260970
4,4-difluoro-1-methylpiperidine;4-(5-formylpyrrolo[2,3-b]pyridin-1-yl)cyclohexa-1,3-diene-1-carboxamide (PubChem CID 163260970) has the molecular formula C21H24F2N4O2 and a molecular weight of 402.45 g/mol. Its IUPAC name is 4,4-difluoro-1-methylpiperidine;4-(5-formylpyrrolo[2,3-b]pyridin-1-yl)cyclohexa-1,3-diene-1-carboxamide.
| Compound Name | 4,4-difluoro-1-methylpiperidine;4-(5-formylpyrrolo[2,3-b]pyridin-1-yl)cyclohexa-1,3-diene-1-carboxamide |
|---|---|
| PubChem CID | 163260970 |
| Molecular Formula | C21H24F2N4O2 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 4,4-difluoro-1-methylpiperidine;4-(5-formylpyrrolo[2,3-b]pyridin-1-yl)cyclohexa-1,3-diene-1-carboxamide |
| SMILES | CN1CCC(F)(F)CC1.NC(=O)C1=CC=C(n2ccc3cc(C=O)cnc32)CC1 |
| InChI | InChI=1S/C15H13N3O2.C6H11F2N/c16-14(20)11-1-3-13(4-2-11)18-6-5-12-7-10(9-19)8-17-15(12)18;1-9-4-2-6(7,8)3-5-9/h1,3,5-9H,2,4H2,(H2,16,20);2-5H2,1H3 |
| InChIKey | OEDWGUNXISAJRW-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|