C23H29F2N7O — CID 163260981
1-[3-[(Z)-2-(aminomethylamino)-1-(methylideneamino)ethenyl]-1,2-dihydropyridin-5-yl]pyrrolo[2,3-b]pyridine-5-carbaldehyde;4,4-difluoro-1-methylpiperidine (PubChem CID 163260981) has the molecular formula C23H29F2N7O and a molecular weight of 457.53 g/mol. Its IUPAC name is 1-[3-[(Z)-2-(aminomethylamino)-1-(methylideneamino)ethenyl]-1,2-dihydropyridin-5-yl]pyrrolo[2,3-b]pyridine-5-carbaldehyde;4,4-difluoro-1-methylpiperidine.
| Compound Name | 1-[3-[(Z)-2-(aminomethylamino)-1-(methylideneamino)ethenyl]-1,2-dihydropyridin-5-yl]pyrrolo[2,3-b]pyridine-5-carbaldehyde;4,4-difluoro-1-methylpiperidine |
|---|---|
| PubChem CID | 163260981 |
| Molecular Formula | C23H29F2N7O |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | 1-[3-[(Z)-2-(aminomethylamino)-1-(methylideneamino)ethenyl]-1,2-dihydropyridin-5-yl]pyrrolo[2,3-b]pyridine-5-carbaldehyde;4,4-difluoro-1-methylpiperidine |
| SMILES | C=N/C(=C\NCN)C1=CC(n2ccc3cc(C=O)cnc32)=CNC1.CN1CCC(F)(F)CC1 |
| InChI | InChI=1S/C17H18N6O.C6H11F2N/c1-19-16(9-21-11-18)14-5-15(8-20-7-14)23-3-2-13-4-12(10-24)6-22-17(13)23;1-9-4-2-6(7,8)3-5-9/h2-6,8-10,20-21H,1,7,11,18H2;2-5H2,1H3/b16-9-; |
| InChIKey | MVFTWBNVZDFSMI-LFMIJCLESA-N |
| XLogP | 2.57 |
| TPSA | 100.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|