C13H17N3 — CID 163261196
3-(3,4-dihydro-2H-pyrrol-2-yl)-5-pyrrolidin-2-ylpyridine (PubChem CID 163261196) has the molecular formula C13H17N3 and a molecular weight of 215.30 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-pyrrol-2-yl)-5-pyrrolidin-2-ylpyridine.
| Compound Name | 3-(3,4-dihydro-2H-pyrrol-2-yl)-5-pyrrolidin-2-ylpyridine |
|---|---|
| PubChem CID | 163261196 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | 3-(3,4-dihydro-2H-pyrrol-2-yl)-5-pyrrolidin-2-ylpyridine |
| SMILES | C1=NC(c2cncc(C3CCCN3)c2)CC1 |
| InChI | InChI=1S/C13H17N3/c1-3-12(15-5-1)10-7-11(9-14-8-10)13-4-2-6-16-13/h5,7-9,12-13,16H,1-4,6H2 |
| InChIKey | ASBXFCWVSQQWOY-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |