About ethane;4-(3-hydroxypropyl)-6,7-dimethyl-1H-quinoxaline-2,3-dione
ethane;4-(3-hydroxypropyl)-6,7-dimethyl-1H-quinoxaline-2,3-dione (PubChem CID 163261559) has the molecular formula C15H22N2O3
and a molecular weight of 278.35 g/mol. Its IUPAC name is ethane;4-(3-hydroxypropyl)-6,7-dimethyl-1H-quinoxaline-2,3-dione.
Molecular Properties
| Compound Name | ethane;4-(3-hydroxypropyl)-6,7-dimethyl-1H-quinoxaline-2,3-dione |
| PubChem CID | 163261559 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | ethane;4-(3-hydroxypropyl)-6,7-dimethyl-1H-quinoxaline-2,3-dione |
| SMILES | CC.Cc1cc2[nH]c(=O)c(=O)n(CCCO)c2cc1C |
| InChI | InChI=1S/C13H16N2O3.C2H6/c1-8-6-10-11(7-9(8)2)15(4-3-5-16)13(18)12(17)14-10;1-2/h6-7,16H,3-5H2,1-2H3,(H,14,17);1-2H3 |
| InChIKey | DTBRKQVRGJPMFU-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze ethane;4-(3-hydroxypropyl)-6,7-dimethyl-1H-quinoxaline-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-(3-hydroxypropyl)-6,7-dimethyl-1H-quinoxaline-2,3-dione?
The IUPAC name of ethane;4-(3-hydroxypropyl)-6,7-dimethyl-1H-quinoxaline-2,3-dione (CID 163261559) is ethane;4-(3-hydroxypropyl)-6,7-dimethyl-1H-quinoxaline-2,3-dione.
What is the SMILES notation for ethane;4-(3-hydroxypropyl)-6,7-dimethyl-1H-quinoxaline-2,3-dione?
The canonical SMILES for ethane;4-(3-hydroxypropyl)-6,7-dimethyl-1H-quinoxaline-2,3-dione is CC.Cc1cc2[nH]c(=O)c(=O)n(CCCO)c2cc1C.
What is the InChIKey of ethane;4-(3-hydroxypropyl)-6,7-dimethyl-1H-quinoxaline-2,3-dione?
The InChIKey is DTBRKQVRGJPMFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O3.C2H6/c1-8-6-10-11(7-9(8)2)15(4-3-5-16)13(18)12(17)14-10;1-2/h6-7,16H,3-5H2,1-2H3,(H,14,17);1-2H3.
What are the key properties of ethane;4-(3-hydroxypropyl)-6,7-dimethyl-1H-quinoxaline-2,3-dione?
ethane;4-(3-hydroxypropyl)-6,7-dimethyl-1H-quinoxaline-2,3-dione has a molecular weight of 278.35 g/mol, XLogP of 1.72, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-(3-hydroxypropyl)-6,7-dimethyl-1H-quinoxaline-2,3-dione is sourced from PubChem (CID 163261559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).