C27H46O2 — CID 163262011
ethane;(3R,17R)-17-[(Z,2R)-hex-3-en-2-yl]-3-hydroxy-10,13-dimethyl-1,2,3,4,5,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-6-one (PubChem CID 163262011) has the molecular formula C27H46O2 and a molecular weight of 402.66 g/mol. Its IUPAC name is ethane;(3R,17R)-17-[(Z,2R)-hex-3-en-2-yl]-3-hydroxy-10,13-dimethyl-1,2,3,4,5,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-6-one.
| Compound Name | ethane;(3R,17R)-17-[(Z,2R)-hex-3-en-2-yl]-3-hydroxy-10,13-dimethyl-1,2,3,4,5,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-6-one |
|---|---|
| PubChem CID | 163262011 |
| Molecular Formula | C27H46O2 |
| Molecular Weight | 402.66 g/mol |
| Exact Mass | 402.35 |
| IUPAC Name | ethane;(3R,17R)-17-[(Z,2R)-hex-3-en-2-yl]-3-hydroxy-10,13-dimethyl-1,2,3,4,5,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-6-one |
| SMILES | CC.CC/C=C\[C@@H](C)[C@H]1CCC2C3CC(=O)C4C[C@H](O)CCC4(C)C3CCC21C |
| InChI | InChI=1S/C25H40O2.C2H6/c1-5-6-7-16(2)19-8-9-20-18-15-23(27)22-14-17(26)10-12-25(22,4)21(18)11-13-24(19,20)3;1-2/h6-7,16-22,26H,5,8-15H2,1-4H3;1-2H3/b7-6-;/t16-,17-,18?,19-,20?,21?,22?,24?,25?;/m1./s1 |
| InChIKey | MXDSSYUJBLOYMF-VTBJJJADSA-N |
| XLogP | 6.81 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.66 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|