C25H27BCl2O4 — CID 163262936
methyl 6-(2,4-dichlorophenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-8,9-dihydro-7H-benzo[7]annulene-2-carboxylate (PubChem CID 163262936) has the molecular formula C25H27BCl2O4 and a molecular weight of 473.21 g/mol. Its IUPAC name is methyl 6-(2,4-dichlorophenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-8,9-dihydro-7H-benzo[7]annulene-2-carboxylate.
| Compound Name | methyl 6-(2,4-dichlorophenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-8,9-dihydro-7H-benzo[7]annulene-2-carboxylate |
|---|---|
| PubChem CID | 163262936 |
| Molecular Formula | C25H27BCl2O4 |
| Molecular Weight | 473.21 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | methyl 6-(2,4-dichlorophenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-8,9-dihydro-7H-benzo[7]annulene-2-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)CCCC(c1ccc(Cl)cc1Cl)=C2B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C25H27BCl2O4/c1-24(2)25(3,4)32-26(31-24)22-18-11-9-16(23(29)30-5)13-15(18)7-6-8-20(22)19-12-10-17(27)14-21(19)28/h9-14H,6-8H2,1-5H3 |
| InChIKey | SMZNCHPSRZIFMG-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.21 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|