About 3-[(4-bromo-2,5-dimethylphenyl)methylidene]azetidine
3-[(4-bromo-2,5-dimethylphenyl)methylidene]azetidine (PubChem CID 163263081) has the molecular formula C12H14BrN
and a molecular weight of 252.15 g/mol. Its IUPAC name is 3-[(4-bromo-2,5-dimethylphenyl)methylidene]azetidine.
Molecular Properties
| Compound Name | 3-[(4-bromo-2,5-dimethylphenyl)methylidene]azetidine |
| PubChem CID | 163263081 |
| Molecular Formula | C12H14BrN |
| Molecular Weight | 252.15 g/mol |
| Exact Mass | 251.03 |
| IUPAC Name | 3-[(4-bromo-2,5-dimethylphenyl)methylidene]azetidine |
| SMILES | Cc1cc(C=C2CNC2)c(C)cc1Br |
| InChI | InChI=1S/C12H14BrN/c1-8-4-12(13)9(2)3-11(8)5-10-6-14-7-10/h3-5,14H,6-7H2,1-2H3 |
| InChIKey | UYTFCHDSSZKNNL-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.15 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-[(4-bromo-2,5-dimethylphenyl)methylidene]azetidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-bromo-2,5-dimethylphenyl)methylidene]azetidine?
The IUPAC name of 3-[(4-bromo-2,5-dimethylphenyl)methylidene]azetidine (CID 163263081) is 3-[(4-bromo-2,5-dimethylphenyl)methylidene]azetidine.
What is the SMILES notation for 3-[(4-bromo-2,5-dimethylphenyl)methylidene]azetidine?
The canonical SMILES for 3-[(4-bromo-2,5-dimethylphenyl)methylidene]azetidine is Cc1cc(C=C2CNC2)c(C)cc1Br.
What is the InChIKey of 3-[(4-bromo-2,5-dimethylphenyl)methylidene]azetidine?
The InChIKey is UYTFCHDSSZKNNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14BrN/c1-8-4-12(13)9(2)3-11(8)5-10-6-14-7-10/h3-5,14H,6-7H2,1-2H3.
What are the key properties of 3-[(4-bromo-2,5-dimethylphenyl)methylidene]azetidine?
3-[(4-bromo-2,5-dimethylphenyl)methylidene]azetidine has a molecular weight of 252.15 g/mol, XLogP of 3.05, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-bromo-2,5-dimethylphenyl)methylidene]azetidine is sourced from PubChem (CID 163263081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).