About N-(2,4-dimethylhexa-2,4,5-trien-3-yl)ethanimine;ethene
N-(2,4-dimethylhexa-2,4,5-trien-3-yl)ethanimine;ethene (PubChem CID 163263223) has the molecular formula C12H19N
and a molecular weight of 177.29 g/mol. Its IUPAC name is N-(2,4-dimethylhexa-2,4,5-trien-3-yl)ethanimine;ethene.
Molecular Properties
| Compound Name | N-(2,4-dimethylhexa-2,4,5-trien-3-yl)ethanimine;ethene |
| PubChem CID | 163263223 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | N-(2,4-dimethylhexa-2,4,5-trien-3-yl)ethanimine;ethene |
| SMILES | C=C.C=C=C(C)C(/N=C/C)=C(C)C |
| InChI | InChI=1S/C10H15N.C2H4/c1-6-9(5)10(8(3)4)11-7-2;1-2/h7H,1H2,2-5H3;1-2H2/b11-7+; |
| InChIKey | DZWKCEJYRGEHLB-RVDQCCQOSA-N |
| XLogP | 3.90 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-(2,4-dimethylhexa-2,4,5-trien-3-yl)ethanimine;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,4-dimethylhexa-2,4,5-trien-3-yl)ethanimine;ethene?
The IUPAC name of N-(2,4-dimethylhexa-2,4,5-trien-3-yl)ethanimine;ethene (CID 163263223) is N-(2,4-dimethylhexa-2,4,5-trien-3-yl)ethanimine;ethene.
What is the SMILES notation for N-(2,4-dimethylhexa-2,4,5-trien-3-yl)ethanimine;ethene?
The canonical SMILES for N-(2,4-dimethylhexa-2,4,5-trien-3-yl)ethanimine;ethene is C=C.C=C=C(C)C(/N=C/C)=C(C)C.
What is the InChIKey of N-(2,4-dimethylhexa-2,4,5-trien-3-yl)ethanimine;ethene?
The InChIKey is DZWKCEJYRGEHLB-RVDQCCQOSA-N. The full InChI is InChI=1S/C10H15N.C2H4/c1-6-9(5)10(8(3)4)11-7-2;1-2/h7H,1H2,2-5H3;1-2H2/b11-7+;.
What are the key properties of N-(2,4-dimethylhexa-2,4,5-trien-3-yl)ethanimine;ethene?
N-(2,4-dimethylhexa-2,4,5-trien-3-yl)ethanimine;ethene has a molecular weight of 177.29 g/mol, XLogP of 3.90, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,4-dimethylhexa-2,4,5-trien-3-yl)ethanimine;ethene is sourced from PubChem (CID 163263223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).