C27H41NO6 — CID 163263275
benzyl 6-[(3aS,7S,7aR)-2,2,7-trimethyl-4-[(2-methylpropan-2-yl)oxymethyl]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridin-5-yl]-6-oxohexanoate (PubChem CID 163263275) has the molecular formula C27H41NO6 and a molecular weight of 475.63 g/mol. Its IUPAC name is benzyl 6-[(3aS,7S,7aR)-2,2,7-trimethyl-4-[(2-methylpropan-2-yl)oxymethyl]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridin-5-yl]-6-oxohexanoate.
| Compound Name | benzyl 6-[(3aS,7S,7aR)-2,2,7-trimethyl-4-[(2-methylpropan-2-yl)oxymethyl]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridin-5-yl]-6-oxohexanoate |
|---|---|
| PubChem CID | 163263275 |
| Molecular Formula | C27H41NO6 |
| Molecular Weight | 475.63 g/mol |
| Exact Mass | 475.29 |
| IUPAC Name | benzyl 6-[(3aS,7S,7aR)-2,2,7-trimethyl-4-[(2-methylpropan-2-yl)oxymethyl]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridin-5-yl]-6-oxohexanoate |
| SMILES | C[C@H]1CN(C(=O)CCCCC(=O)OCc2ccccc2)C(COC(C)(C)C)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C27H41NO6/c1-19-16-28(21(18-32-26(2,3)4)25-24(19)33-27(5,6)34-25)22(29)14-10-11-15-23(30)31-17-20-12-8-7-9-13-20/h7-9,12-13,19,21,24-25H,10-11,14-18H2,1-6H3/t19-,21?,24+,25-/m0/s1 |
| InChIKey | LYGIABICPSWXAM-FIPPTWHASA-N |
| XLogP | 4.47 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.63 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|