C21H31NO5 — CID 163263290
(3aR,7R,7aR)-7-hydroxy-2,2-dimethyl-5-(6-phenylmethoxyhexyl)-3a,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-4-one (PubChem CID 163263290) has the molecular formula C21H31NO5 and a molecular weight of 377.48 g/mol. Its IUPAC name is (3aR,7R,7aR)-7-hydroxy-2,2-dimethyl-5-(6-phenylmethoxyhexyl)-3a,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-4-one.
| Compound Name | (3aR,7R,7aR)-7-hydroxy-2,2-dimethyl-5-(6-phenylmethoxyhexyl)-3a,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-4-one |
|---|---|
| PubChem CID | 163263290 |
| Molecular Formula | C21H31NO5 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | (3aR,7R,7aR)-7-hydroxy-2,2-dimethyl-5-(6-phenylmethoxyhexyl)-3a,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-4-one |
| SMILES | CC1(C)O[C@@H]2[C@H](O)CN(CCCCCCOCc3ccccc3)C(=O)[C@@H]2O1 |
| InChI | InChI=1S/C21H31NO5/c1-21(2)26-18-17(23)14-22(20(24)19(18)27-21)12-8-3-4-9-13-25-15-16-10-6-5-7-11-16/h5-7,10-11,17-19,23H,3-4,8-9,12-15H2,1-2H3/t17-,18-,19-/m1/s1 |
| InChIKey | YKZAYHCKAUSQNE-GUDVDZBRSA-N |
| XLogP | 2.49 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|