C27H45NO5Si — CID 163263359
(3aR,7R,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-5-(6-phenylmethoxyhexyl)-3a,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-4-one (PubChem CID 163263359) has the molecular formula C27H45NO5Si and a molecular weight of 491.75 g/mol. Its IUPAC name is (3aR,7R,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-5-(6-phenylmethoxyhexyl)-3a,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-4-one.
| Compound Name | (3aR,7R,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-5-(6-phenylmethoxyhexyl)-3a,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-4-one |
|---|---|
| PubChem CID | 163263359 |
| Molecular Formula | C27H45NO5Si |
| Molecular Weight | 491.75 g/mol |
| Exact Mass | 491.31 |
| IUPAC Name | (3aR,7R,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-5-(6-phenylmethoxyhexyl)-3a,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-4-one |
| SMILES | CC1(C)O[C@@H]2[C@H](O[Si](C)(C)C(C)(C)C)CN(CCCCCCOCc3ccccc3)C(=O)[C@@H]2O1 |
| InChI | InChI=1S/C27H45NO5Si/c1-26(2,3)34(6,7)33-22-19-28(25(29)24-23(22)31-27(4,5)32-24)17-13-8-9-14-18-30-20-21-15-11-10-12-16-21/h10-12,15-16,22-24H,8-9,13-14,17-20H2,1-7H3/t22-,23-,24-/m1/s1 |
| InChIKey | COFLVAUJJMXMJB-WXFUMESZSA-N |
| XLogP | 5.52 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.75 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|