C27H46N2O6S4 — CID 163263934
1-[3-[2-[[3-(2-carboxypyrrolidin-1-yl)-2-methyl-3-oxopropyl]disulfanyl]nonyldisulfanyl]-2-methylpropanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 163263934) has the molecular formula C27H46N2O6S4 and a molecular weight of 622.94 g/mol. Its IUPAC name is 1-[3-[2-[[3-(2-carboxypyrrolidin-1-yl)-2-methyl-3-oxopropyl]disulfanyl]nonyldisulfanyl]-2-methylpropanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[3-[2-[[3-(2-carboxypyrrolidin-1-yl)-2-methyl-3-oxopropyl]disulfanyl]nonyldisulfanyl]-2-methylpropanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 163263934 |
| Molecular Formula | C27H46N2O6S4 |
| Molecular Weight | 622.94 g/mol |
| Exact Mass | 622.22 |
| IUPAC Name | 1-[3-[2-[[3-(2-carboxypyrrolidin-1-yl)-2-methyl-3-oxopropyl]disulfanyl]nonyldisulfanyl]-2-methylpropanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | CCCCCCCC(CSSCC(C)C(=O)N1CCCC1C(=O)O)SSCC(C)C(=O)N1CCCC1C(=O)O |
| InChI | InChI=1S/C27H46N2O6S4/c1-4-5-6-7-8-11-21(39-38-17-20(3)25(31)29-15-10-13-23(29)27(34)35)18-37-36-16-19(2)24(30)28-14-9-12-22(28)26(32)33/h19-23H,4-18H2,1-3H3,(H,32,33)(H,34,35) |
| InChIKey | YBPNSXXEEHLLKX-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.94 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|