C36H54N4OS — CID 163263983
1-[(1Z)-1-(4-amino-3-sulfanylphenyl)buta-1,3-dienyl]-N-(3-methylpentyl)-N,5-dipropylpyrazole-3-carboxamide;(2Z,4Z,6E)-6-methylnona-2,4,6-triene (PubChem CID 163263983) has the molecular formula C36H54N4OS and a molecular weight of 590.92 g/mol. Its IUPAC name is 1-[(1Z)-1-(4-amino-3-sulfanylphenyl)buta-1,3-dienyl]-N-(3-methylpentyl)-N,5-dipropylpyrazole-3-carboxamide;(2Z,4Z,6E)-6-methylnona-2,4,6-triene.
| Compound Name | 1-[(1Z)-1-(4-amino-3-sulfanylphenyl)buta-1,3-dienyl]-N-(3-methylpentyl)-N,5-dipropylpyrazole-3-carboxamide;(2Z,4Z,6E)-6-methylnona-2,4,6-triene |
|---|---|
| PubChem CID | 163263983 |
| Molecular Formula | C36H54N4OS |
| Molecular Weight | 590.92 g/mol |
| Exact Mass | 590.40 |
| IUPAC Name | 1-[(1Z)-1-(4-amino-3-sulfanylphenyl)buta-1,3-dienyl]-N-(3-methylpentyl)-N,5-dipropylpyrazole-3-carboxamide;(2Z,4Z,6E)-6-methylnona-2,4,6-triene |
| SMILES | C/C=C\C=C/C(C)=C/CC.C=C/C=C(/c1ccc(N)c(S)c1)n1nc(C(=O)N(CCC)CCC(C)CC)cc1CCC |
| InChI | InChI=1S/C26H38N4OS.C10H16/c1-6-10-21-18-23(26(31)29(15-8-3)16-14-19(5)9-4)28-30(21)24(11-7-2)20-12-13-22(27)25(32)17-20;1-4-6-7-9-10(3)8-5-2/h7,11-13,17-19,32H,2,6,8-10,14-16,27H2,1,3-5H3;4,6-9H,5H2,1-3H3/b24-11-;6-4-,9-7-,10-8+ |
| InChIKey | JCYXZTWQQGCTIK-DJBOBMAUSA-N |
| XLogP | 9.55 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.92 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|