C31H37N2O4U- — CID 163264031
1-[1-[(1Z)-1-(3,4-dimethoxyphenyl)-4-methylhexa-1,3-dienyl]-5-methylpyrazol-3-yl]butan-1-one;(4-methylphenyl)methanone;uranium (PubChem CID 163264031) has the molecular formula C31H37N2O4U- and a molecular weight of 739.68 g/mol. Its IUPAC name is 1-[1-[(1Z)-1-(3,4-dimethoxyphenyl)-4-methylhexa-1,3-dienyl]-5-methylpyrazol-3-yl]butan-1-one;(4-methylphenyl)methanone;uranium.
| Compound Name | 1-[1-[(1Z)-1-(3,4-dimethoxyphenyl)-4-methylhexa-1,3-dienyl]-5-methylpyrazol-3-yl]butan-1-one;(4-methylphenyl)methanone;uranium |
|---|---|
| PubChem CID | 163264031 |
| Molecular Formula | C31H37N2O4U- |
| Molecular Weight | 739.68 g/mol |
| Exact Mass | 739.33 |
| IUPAC Name | 1-[1-[(1Z)-1-(3,4-dimethoxyphenyl)-4-methylhexa-1,3-dienyl]-5-methylpyrazol-3-yl]butan-1-one;(4-methylphenyl)methanone;uranium |
| SMILES | CCCC(=O)c1cc(C)n(/C(=C\C=C(C)CC)c2ccc(OC)c(OC)c2)n1.Cc1ccc([C-]=O)cc1.[U] |
| InChI | InChI=1S/C23H30N2O3.C8H7O.U/c1-7-9-21(26)19-14-17(4)25(24-19)20(12-10-16(3)8-2)18-11-13-22(27-5)23(15-18)28-6;1-7-2-4-8(6-9)5-3-7;/h10-15H,7-9H2,1-6H3;2-5H,1H3;/q;-1;/b16-10?,20-12-;; |
| InChIKey | SCLWCJSBXWXTEG-SJTUVEMXSA-N |
| XLogP | 6.89 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.68 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|