C20H36N2O2 — CID 163264423
ethane;(2E,4Z)-2-methyl-1-[2-methyl-4-(2-methylpropanoyl)piperazin-1-yl]octa-2,4-dien-1-one (PubChem CID 163264423) has the molecular formula C20H36N2O2 and a molecular weight of 336.52 g/mol. Its IUPAC name is ethane;(2E,4Z)-2-methyl-1-[2-methyl-4-(2-methylpropanoyl)piperazin-1-yl]octa-2,4-dien-1-one.
| Compound Name | ethane;(2E,4Z)-2-methyl-1-[2-methyl-4-(2-methylpropanoyl)piperazin-1-yl]octa-2,4-dien-1-one |
|---|---|
| PubChem CID | 163264423 |
| Molecular Formula | C20H36N2O2 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.28 |
| IUPAC Name | ethane;(2E,4Z)-2-methyl-1-[2-methyl-4-(2-methylpropanoyl)piperazin-1-yl]octa-2,4-dien-1-one |
| SMILES | CC.CCC/C=C\C=C(/C)C(=O)N1CCN(C(=O)C(C)C)CC1C |
| InChI | InChI=1S/C18H30N2O2.C2H6/c1-6-7-8-9-10-15(4)18(22)20-12-11-19(13-16(20)5)17(21)14(2)3;1-2/h8-10,14,16H,6-7,11-13H2,1-5H3;1-2H3/b9-8-,15-10+; |
| InChIKey | BCRKXBGTCRJJEU-UZVSKMOGSA-N |
| XLogP | 4.03 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|