About ethenol;1-methyl-4-(2-methylpropyl)benzene
ethenol;1-methyl-4-(2-methylpropyl)benzene (PubChem CID 163264631) has the molecular formula C13H20O
and a molecular weight of 192.30 g/mol. Its IUPAC name is ethenol;1-methyl-4-(2-methylpropyl)benzene.
Molecular Properties
| Compound Name | ethenol;1-methyl-4-(2-methylpropyl)benzene |
| PubChem CID | 163264631 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | ethenol;1-methyl-4-(2-methylpropyl)benzene |
| SMILES | C=CO.Cc1ccc(CC(C)C)cc1 |
| InChI | InChI=1S/C11H16.C2H4O/c1-9(2)8-11-6-4-10(3)5-7-11;1-2-3/h4-7,9H,8H2,1-3H3;2-3H,1H2 |
| InChIKey | UZJFQATWPCWCOZ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze ethenol;1-methyl-4-(2-methylpropyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenol;1-methyl-4-(2-methylpropyl)benzene?
The IUPAC name of ethenol;1-methyl-4-(2-methylpropyl)benzene (CID 163264631) is ethenol;1-methyl-4-(2-methylpropyl)benzene.
What is the SMILES notation for ethenol;1-methyl-4-(2-methylpropyl)benzene?
The canonical SMILES for ethenol;1-methyl-4-(2-methylpropyl)benzene is C=CO.Cc1ccc(CC(C)C)cc1.
What is the InChIKey of ethenol;1-methyl-4-(2-methylpropyl)benzene?
The InChIKey is UZJFQATWPCWCOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16.C2H4O/c1-9(2)8-11-6-4-10(3)5-7-11;1-2-3/h4-7,9H,8H2,1-3H3;2-3H,1H2.
What are the key properties of ethenol;1-methyl-4-(2-methylpropyl)benzene?
ethenol;1-methyl-4-(2-methylpropyl)benzene has a molecular weight of 192.30 g/mol, XLogP of 3.88, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethenol;1-methyl-4-(2-methylpropyl)benzene is sourced from PubChem (CID 163264631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).