About methyl butanoate;2-methyl-1-(3-methylpyrrolidin-1-yl)propan-1-one
methyl butanoate;2-methyl-1-(3-methylpyrrolidin-1-yl)propan-1-one (PubChem CID 163264648) has the molecular formula C14H27NO3
and a molecular weight of 257.37 g/mol. Its IUPAC name is methyl butanoate;2-methyl-1-(3-methylpyrrolidin-1-yl)propan-1-one.
Molecular Properties
| Compound Name | methyl butanoate;2-methyl-1-(3-methylpyrrolidin-1-yl)propan-1-one |
| PubChem CID | 163264648 |
| Molecular Formula | C14H27NO3 |
| Molecular Weight | 257.37 g/mol |
| Exact Mass | 257.20 |
| IUPAC Name | methyl butanoate;2-methyl-1-(3-methylpyrrolidin-1-yl)propan-1-one |
| SMILES | CC1CCN(C(=O)C(C)C)C1.CCCC(=O)OC |
| InChI | InChI=1S/C9H17NO.C5H10O2/c1-7(2)9(11)10-5-4-8(3)6-10;1-3-4-5(6)7-2/h7-8H,4-6H2,1-3H3;3-4H2,1-2H3 |
| InChIKey | IBQCHGYASUAMQJ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.37 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl butanoate;2-methyl-1-(3-methylpyrrolidin-1-yl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl butanoate;2-methyl-1-(3-methylpyrrolidin-1-yl)propan-1-one?
The IUPAC name of methyl butanoate;2-methyl-1-(3-methylpyrrolidin-1-yl)propan-1-one (CID 163264648) is methyl butanoate;2-methyl-1-(3-methylpyrrolidin-1-yl)propan-1-one.
What is the SMILES notation for methyl butanoate;2-methyl-1-(3-methylpyrrolidin-1-yl)propan-1-one?
The canonical SMILES for methyl butanoate;2-methyl-1-(3-methylpyrrolidin-1-yl)propan-1-one is CC1CCN(C(=O)C(C)C)C1.CCCC(=O)OC.
What is the InChIKey of methyl butanoate;2-methyl-1-(3-methylpyrrolidin-1-yl)propan-1-one?
The InChIKey is IBQCHGYASUAMQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO.C5H10O2/c1-7(2)9(11)10-5-4-8(3)6-10;1-3-4-5(6)7-2/h7-8H,4-6H2,1-3H3;3-4H2,1-2H3.
What are the key properties of methyl butanoate;2-methyl-1-(3-methylpyrrolidin-1-yl)propan-1-one?
methyl butanoate;2-methyl-1-(3-methylpyrrolidin-1-yl)propan-1-one has a molecular weight of 257.37 g/mol, XLogP of 2.47, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl butanoate;2-methyl-1-(3-methylpyrrolidin-1-yl)propan-1-one is sourced from PubChem (CID 163264648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).