C19H21N3O — CID 163264979
1-[7-(3,4-dimethylphenyl)pyrazolo[1,5-a]pyrimidin-2-yl]prop-2-yn-1-one;ethane;molecular hydrogen (PubChem CID 163264979) has the molecular formula C19H21N3O and a molecular weight of 307.40 g/mol. Its IUPAC name is 1-[7-(3,4-dimethylphenyl)pyrazolo[1,5-a]pyrimidin-2-yl]prop-2-yn-1-one;ethane;molecular hydrogen.
| Compound Name | 1-[7-(3,4-dimethylphenyl)pyrazolo[1,5-a]pyrimidin-2-yl]prop-2-yn-1-one;ethane;molecular hydrogen |
|---|---|
| PubChem CID | 163264979 |
| Molecular Formula | C19H21N3O |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | 1-[7-(3,4-dimethylphenyl)pyrazolo[1,5-a]pyrimidin-2-yl]prop-2-yn-1-one;ethane;molecular hydrogen |
| SMILES | C#CC(=O)c1cc2nccc(-c3ccc(C)c(C)c3)n2n1.CC.[H][H] |
| InChI | InChI=1S/C17H13N3O.C2H6.H2/c1-4-16(21)14-10-17-18-8-7-15(20(17)19-14)13-6-5-11(2)12(3)9-13;1-2;/h1,5-10H,2-3H3;1-2H3;1H |
| InChIKey | YTKMNHVCAKZGCH-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|