C34H60O4 — CID 163265206
[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-oxobutanoate;ethane;methanol (PubChem CID 163265206) has the molecular formula C34H60O4 and a molecular weight of 532.85 g/mol. Its IUPAC name is [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-oxobutanoate;ethane;methanol.
| Compound Name | [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-oxobutanoate;ethane;methanol |
|---|---|
| PubChem CID | 163265206 |
| Molecular Formula | C34H60O4 |
| Molecular Weight | 532.85 g/mol |
| Exact Mass | 532.45 |
| IUPAC Name | [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-oxobutanoate;ethane;methanol |
| SMILES | CC.CC(C)CCCC(C)C1CCC2C3CC=C4CC(OC(=O)CCC=O)CCC4(C)C3CCC12C.CO |
| InChI | InChI=1S/C31H50O3.C2H6.CH4O/c1-21(2)8-6-9-22(3)26-13-14-27-25-12-11-23-20-24(34-29(33)10-7-19-32)15-17-30(23,4)28(25)16-18-31(26,27)5;2*1-2/h11,19,21-22,24-28H,6-10,12-18,20H2,1-5H3;1-2H3;2H,1H3 |
| InChIKey | LFDGVBRBMNHMPW-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.85 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|