About 2-[[5-[1-(2,3-dimethylphenyl)ethyl]imidazole-1-carbonyl]amino]ethyl prop-2-enoate
2-[[5-[1-(2,3-dimethylphenyl)ethyl]imidazole-1-carbonyl]amino]ethyl prop-2-enoate (PubChem CID 163265483) has the molecular formula C19H23N3O3
and a molecular weight of 341.41 g/mol. Its IUPAC name is 2-[[5-[1-(2,3-dimethylphenyl)ethyl]imidazole-1-carbonyl]amino]ethyl prop-2-enoate.
Molecular Properties
| Compound Name | 2-[[5-[1-(2,3-dimethylphenyl)ethyl]imidazole-1-carbonyl]amino]ethyl prop-2-enoate |
| PubChem CID | 163265483 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 2-[[5-[1-(2,3-dimethylphenyl)ethyl]imidazole-1-carbonyl]amino]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCNC(=O)n1cncc1C(C)c1cccc(C)c1C |
| InChI | InChI=1S/C19H23N3O3/c1-5-18(23)25-10-9-21-19(24)22-12-20-11-17(22)15(4)16-8-6-7-13(2)14(16)3/h5-8,11-12,15H,1,9-10H2,2-4H3,(H,21,24) |
| InChIKey | LVYLPEDPQKDSFY-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[[5-[1-(2,3-dimethylphenyl)ethyl]imidazole-1-carbonyl]amino]ethyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[5-[1-(2,3-dimethylphenyl)ethyl]imidazole-1-carbonyl]amino]ethyl prop-2-enoate?
The IUPAC name of 2-[[5-[1-(2,3-dimethylphenyl)ethyl]imidazole-1-carbonyl]amino]ethyl prop-2-enoate (CID 163265483) is 2-[[5-[1-(2,3-dimethylphenyl)ethyl]imidazole-1-carbonyl]amino]ethyl prop-2-enoate.
What is the SMILES notation for 2-[[5-[1-(2,3-dimethylphenyl)ethyl]imidazole-1-carbonyl]amino]ethyl prop-2-enoate?
The canonical SMILES for 2-[[5-[1-(2,3-dimethylphenyl)ethyl]imidazole-1-carbonyl]amino]ethyl prop-2-enoate is C=CC(=O)OCCNC(=O)n1cncc1C(C)c1cccc(C)c1C.
What is the InChIKey of 2-[[5-[1-(2,3-dimethylphenyl)ethyl]imidazole-1-carbonyl]amino]ethyl prop-2-enoate?
The InChIKey is LVYLPEDPQKDSFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23N3O3/c1-5-18(23)25-10-9-21-19(24)22-12-20-11-17(22)15(4)16-8-6-7-13(2)14(16)3/h5-8,11-12,15H,1,9-10H2,2-4H3,(H,21,24).
What are the key properties of 2-[[5-[1-(2,3-dimethylphenyl)ethyl]imidazole-1-carbonyl]amino]ethyl prop-2-enoate?
2-[[5-[1-(2,3-dimethylphenyl)ethyl]imidazole-1-carbonyl]amino]ethyl prop-2-enoate has a molecular weight of 341.41 g/mol, XLogP of 2.94, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[5-[1-(2,3-dimethylphenyl)ethyl]imidazole-1-carbonyl]amino]ethyl prop-2-enoate is sourced from PubChem (CID 163265483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).