C24H19F6N5O2 — CID 163265520
3-(2-amino-[1,2,4]triazolo[1,5-a]pyridin-7-yl)-2-fluoro-6-methyl-N-[2,2,4,4-tetrafluoro-3-(4-fluorophenyl)-3-hydroxybutyl]benzamide (PubChem CID 163265520) has the molecular formula C24H19F6N5O2 and a molecular weight of 523.44 g/mol. Its IUPAC name is 3-(2-amino-[1,2,4]triazolo[1,5-a]pyridin-7-yl)-2-fluoro-6-methyl-N-[2,2,4,4-tetrafluoro-3-(4-fluorophenyl)-3-hydroxybutyl]benzamide.
| Compound Name | 3-(2-amino-[1,2,4]triazolo[1,5-a]pyridin-7-yl)-2-fluoro-6-methyl-N-[2,2,4,4-tetrafluoro-3-(4-fluorophenyl)-3-hydroxybutyl]benzamide |
|---|---|
| PubChem CID | 163265520 |
| Molecular Formula | C24H19F6N5O2 |
| Molecular Weight | 523.44 g/mol |
| Exact Mass | 523.14 |
| IUPAC Name | 3-(2-amino-[1,2,4]triazolo[1,5-a]pyridin-7-yl)-2-fluoro-6-methyl-N-[2,2,4,4-tetrafluoro-3-(4-fluorophenyl)-3-hydroxybutyl]benzamide |
| SMILES | Cc1ccc(-c2ccn3nc(N)nc3c2)c(F)c1C(=O)NCC(F)(F)C(O)(c1ccc(F)cc1)C(F)F |
| InChI | InChI=1S/C24H19F6N5O2/c1-12-2-7-16(13-8-9-35-17(10-13)33-22(31)34-35)19(26)18(12)20(36)32-11-23(29,30)24(37,21(27)28)14-3-5-15(25)6-4-14/h2-10,21,37H,11H2,1H3,(H2,31,34)(H,32,36) |
| InChIKey | IDYWYWMLLZTBSA-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 105.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.44 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |