C9H8F3NO2 — CID 163265678
(3R)-2,2-difluoro-3-(4-fluorophenyl)-3-hydroxypropanamide (PubChem CID 163265678) has the molecular formula C9H8F3NO2 and a molecular weight of 219.16 g/mol. Its IUPAC name is (3R)-2,2-difluoro-3-(4-fluorophenyl)-3-hydroxypropanamide.
| Compound Name | (3R)-2,2-difluoro-3-(4-fluorophenyl)-3-hydroxypropanamide |
|---|---|
| PubChem CID | 163265678 |
| Molecular Formula | C9H8F3NO2 |
| Molecular Weight | 219.16 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | (3R)-2,2-difluoro-3-(4-fluorophenyl)-3-hydroxypropanamide |
| SMILES | NC(=O)C(F)(F)[C@H](O)c1ccc(F)cc1 |
| InChI | InChI=1S/C9H8F3NO2/c10-6-3-1-5(2-4-6)7(14)9(11,12)8(13)15/h1-4,7,14H,(H2,13,15)/t7-/m1/s1 |
| InChIKey | YMHWSRSCQBOXRN-SSDOTTSWSA-N |
| XLogP | 0.98 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.16 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |