C14H10ClF4NO — CID 163265814
6-chloro-2-(4-fluorophenyl)-4-methyl-3-(2,2,2-trifluoroethoxy)pyridine (PubChem CID 163265814) has the molecular formula C14H10ClF4NO and a molecular weight of 319.69 g/mol. Its IUPAC name is 6-chloro-2-(4-fluorophenyl)-4-methyl-3-(2,2,2-trifluoroethoxy)pyridine.
| Compound Name | 6-chloro-2-(4-fluorophenyl)-4-methyl-3-(2,2,2-trifluoroethoxy)pyridine |
|---|---|
| PubChem CID | 163265814 |
| Molecular Formula | C14H10ClF4NO |
| Molecular Weight | 319.69 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | 6-chloro-2-(4-fluorophenyl)-4-methyl-3-(2,2,2-trifluoroethoxy)pyridine |
| SMILES | Cc1cc(Cl)nc(-c2ccc(F)cc2)c1OCC(F)(F)F |
| InChI | InChI=1S/C14H10ClF4NO/c1-8-6-11(15)20-12(9-2-4-10(16)5-3-9)13(8)21-7-14(17,18)19/h2-6H,7H2,1H3 |
| InChIKey | QAEIWXNQXXPREJ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.69 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|