C14H25NO — CID 163265833
(4E)-4-cyclopropyloxy-2,6-dimethylhepta-2,4,6-trien-3-amine;ethane (PubChem CID 163265833) has the molecular formula C14H25NO and a molecular weight of 223.36 g/mol. Its IUPAC name is (4E)-4-cyclopropyloxy-2,6-dimethylhepta-2,4,6-trien-3-amine;ethane.
| Compound Name | (4E)-4-cyclopropyloxy-2,6-dimethylhepta-2,4,6-trien-3-amine;ethane |
|---|---|
| PubChem CID | 163265833 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | (4E)-4-cyclopropyloxy-2,6-dimethylhepta-2,4,6-trien-3-amine;ethane |
| SMILES | C=C(C)/C=C(/OC1CC1)C(N)=C(C)C.CC |
| InChI | InChI=1S/C12H19NO.C2H6/c1-8(2)7-11(12(13)9(3)4)14-10-5-6-10;1-2/h7,10H,1,5-6,13H2,2-4H3;1-2H3/b11-7+; |
| InChIKey | KATODSRCKNMMGP-RVDQCCQOSA-N |
| XLogP | 3.90 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|