C25H29NO6 — CID 163268102
methyl formate;methyl 2-(3'-oxo-5'-phenylmethoxyspiro[cyclopropane-1,1'-isoindole]-2'-yl)pentanoate (PubChem CID 163268102) has the molecular formula C25H29NO6 and a molecular weight of 439.51 g/mol. Its IUPAC name is methyl formate;methyl 2-(3'-oxo-5'-phenylmethoxyspiro[cyclopropane-1,1'-isoindole]-2'-yl)pentanoate.
| Compound Name | methyl formate;methyl 2-(3'-oxo-5'-phenylmethoxyspiro[cyclopropane-1,1'-isoindole]-2'-yl)pentanoate |
|---|---|
| PubChem CID | 163268102 |
| Molecular Formula | C25H29NO6 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | methyl formate;methyl 2-(3'-oxo-5'-phenylmethoxyspiro[cyclopropane-1,1'-isoindole]-2'-yl)pentanoate |
| SMILES | CCCC(C(=O)OC)N1C(=O)c2cc(OCc3ccccc3)ccc2C12CC2.COC=O |
| InChI | InChI=1S/C23H25NO4.C2H4O2/c1-3-7-20(22(26)27-2)24-21(25)18-14-17(10-11-19(18)23(24)12-13-23)28-15-16-8-5-4-6-9-16;1-4-2-3/h4-6,8-11,14,20H,3,7,12-13,15H2,1-2H3;2H,1H3 |
| InChIKey | IKTAWSMNDWDRAG-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|