About CID 163268598
CID 163268598 (PubChem CID 163268598) has the molecular formula C16H33BN2
and a molecular weight of 264.27 g/mol.
Molecular Properties
| Compound Name | CID 163268598 |
| PubChem CID | 163268598 |
| Molecular Formula | C16H33BN2 |
| Molecular Weight | 264.27 g/mol |
| Exact Mass | 264.27 |
| IUPAC Name | — |
| SMILES | CC.CC.[B]C1(C)CCC2/C(=N/C)N(C)CCC2C1 |
| InChI | InChI=1S/C12H21BN2.2C2H6/c1-12(13)6-4-10-9(8-12)5-7-15(3)11(10)14-2;2*1-2/h9-10H,4-8H2,1-3H3;2*1-2H3/b14-11-;; |
| InChIKey | DFSQXUPSIDJXIA-LVDFRVDWSA-N |
| XLogP | 4.17 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.27 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze CID 163268598 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 163268598?
The IUPAC name of CID 163268598 (CID 163268598) is not available.
What is the SMILES notation for CID 163268598?
The canonical SMILES for CID 163268598 is CC.CC.[B]C1(C)CCC2/C(=N/C)N(C)CCC2C1.
What is the InChIKey of CID 163268598?
The InChIKey is DFSQXUPSIDJXIA-LVDFRVDWSA-N. The full InChI is InChI=1S/C12H21BN2.2C2H6/c1-12(13)6-4-10-9(8-12)5-7-15(3)11(10)14-2;2*1-2/h9-10H,4-8H2,1-3H3;2*1-2H3/b14-11-;;.
What are the key properties of CID 163268598?
CID 163268598 has a molecular weight of 264.27 g/mol, XLogP of 4.17, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 163268598 is sourced from PubChem (CID 163268598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).