C17H27NOS — CID 163269280
buta-1,3-diene;ethane;(2E)-2-methyl-1-(1,3-thiazol-4-yl)penta-2,4-dien-1-one (PubChem CID 163269280) has the molecular formula C17H27NOS and a molecular weight of 293.48 g/mol. Its IUPAC name is buta-1,3-diene;ethane;(2E)-2-methyl-1-(1,3-thiazol-4-yl)penta-2,4-dien-1-one.
| Compound Name | buta-1,3-diene;ethane;(2E)-2-methyl-1-(1,3-thiazol-4-yl)penta-2,4-dien-1-one |
|---|---|
| PubChem CID | 163269280 |
| Molecular Formula | C17H27NOS |
| Molecular Weight | 293.48 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | buta-1,3-diene;ethane;(2E)-2-methyl-1-(1,3-thiazol-4-yl)penta-2,4-dien-1-one |
| SMILES | C=C/C=C(\C)C(=O)c1cscn1.C=CC=C.CC.CC |
| InChI | InChI=1S/C9H9NOS.C4H6.2C2H6/c1-3-4-7(2)9(11)8-5-12-6-10-8;1-3-4-2;2*1-2/h3-6H,1H2,2H3;3-4H,1-2H2;2*1-2H3/b7-4+;;; |
| InChIKey | KOSHCIWUDCKSQZ-QNEYZHQCSA-N |
| XLogP | 5.87 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.48 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|