C12H15F3O4 — CID 163269520
ethyl 2-hydroxy-3-prop-2-enyl-6-(trifluoromethyl)-3,4-dihydro-2H-pyran-5-carboxylate (PubChem CID 163269520) has the molecular formula C12H15F3O4 and a molecular weight of 280.24 g/mol. Its IUPAC name is ethyl 2-hydroxy-3-prop-2-enyl-6-(trifluoromethyl)-3,4-dihydro-2H-pyran-5-carboxylate.
| Compound Name | ethyl 2-hydroxy-3-prop-2-enyl-6-(trifluoromethyl)-3,4-dihydro-2H-pyran-5-carboxylate |
|---|---|
| PubChem CID | 163269520 |
| Molecular Formula | C12H15F3O4 |
| Molecular Weight | 280.24 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | ethyl 2-hydroxy-3-prop-2-enyl-6-(trifluoromethyl)-3,4-dihydro-2H-pyran-5-carboxylate |
| SMILES | C=CCC1CC(C(=O)OCC)=C(C(F)(F)F)OC1O |
| InChI | InChI=1S/C12H15F3O4/c1-3-5-7-6-8(11(17)18-4-2)9(12(13,14)15)19-10(7)16/h3,7,10,16H,1,4-6H2,2H3 |
| InChIKey | ZYEHVERPKNTIFJ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.24 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|